ChemNet > CAS > 102-39-6 m-phenylenedioxydi(acetic acid)
102-39-6 m-phenylenedioxydi(acetic acid)
| product Name |
m-phenylenedioxydi(acetic acid) |
| CAS No |
102-39-6 |
| Synonyms |
Resorcinol-O,O-diacetic acid; 1,3-Bis(carboxymethoxy)benzene; Resorcinol-O,O-diacetic acid; 2,2'-[benzene-1,3-diylbis(oxy)]diacetic acid |
| Molecular Formula |
C10H10O6 |
| Molecular Weight |
226.1828 |
| InChI |
InChI=1/C10H10O6/c11-9(12)5-15-7-2-1-3-8(4-7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
| EINECS |
203-027-8 |
| Molecular Structure |
|
| Density |
1.416g/cm3 |
| Boiling point |
447.4°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
180.4°C |
| Vapour Pressur |
8.65E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
